![[ICO]](/icons/blank.gif){kind=icon}
![[PARENTDIR]](/icons/back.gif){kind=icon}
![[SND]](/icons/sound2.gif){kind=icon}
| Name | Last modified | Size | Description |
|---|---|---|---|---|
| Parent Directory | - | ||
| 01. Ki.flac | 2025-08-04 23:51 | 8.4M | |
| 02. Alpha.flac | 2025-08-04 23:51 | 42M | |
| 03. Dead Voxel.flac | 2025-08-04 23:51 | 16M | |
| 04. Blind Spots.flac | 2025-08-04 23:51 | 28M | |
| 05. Flake.flac | 2025-08-04 23:51 | 13M | |
| 06. Moog City 2.flac | 2025-08-04 23:51 | 11M | |
| 07. Concrete Halls.flac | 2025-08-04 23:51 | 19M | |
| 08. Biome Fest.flac | 2025-08-04 23:51 | 29M | |
| 09. Mutation.flac | 2025-08-04 23:51 | 13M | |
| 10. Haunt Muskie.flac | 2025-08-04 23:51 | 28M | |
| 11. Warmth.flac | 2025-08-04 23:51 | 17M | |
| 12. Floating Trees.flac | 2025-08-04 23:51 | 15M | |
| 13. Aria Math.flac | 2025-08-04 23:51 | 31M | |
| 14. Kyoto.flac | 2025-08-04 23:51 | 16M | |
| 15. Ballad of the Ca..> | 2025-08-04 23:51 | 16M | |
| 16. Taswell.flac | 2025-08-04 23:51 | 38M | |
| 17. Beginning 2.flac | 2025-08-04 23:51 | 12M | |
| 18. Dreiton.flac | 2025-08-04 23:51 | 46M | |
| 19. The End.flac | 2025-08-04 23:51 | 61M | |
| 20. Chirp.flac | 2025-08-04 23:51 | 18M | |
| 21. Wait.flac | 2025-08-04 23:51 | 23M | |
| 22. Mellohi.flac | 2025-08-04 23:51 | 7.8M | |
| 23. Stal.flac | 2025-08-04 23:51 | 14M | |
| 24. Strad.flac | 2025-08-04 23:51 | 19M | |
| 25. Eleven.flac | 2025-08-04 23:51 | 4.8M | |
| 26. Ward.flac | 2025-08-04 23:51 | 25M | |
| 27. Mall.flac | 2025-08-04 23:51 | 16M | |
| 28. Blocks.flac | 2025-08-04 23:51 | 32M | |
| 29. Far.flac | 2025-08-04 23:51 | 16M | |
| 30. Intro.flac | 2025-08-04 23:51 | 24M | |